![2-methyl-3H-thieno[2,3-d]pyrimidin-4-one (CAS: 21582-51-4) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0753584.png "2-methyl-3H-thieno[2,3-d]pyrimidin-4-one chemical structure")
2-methyl-3H-thieno[2,3-d]pyrimidin-4-one
Catalog No: FT-0753584
CAS No: 21582-51-4
- Chemical Name: 2-methyl-3H-thieno[2,3-d]pyrimidin-4-one
- Molecular Formula: C7H6N2OS
- Molecular Weight: 166.2
- InChI Key: YAGLWUMMXGHFDI-UHFFFAOYSA-N
- InChI: InChI=1S/C7H6N2OS/c1-4-8-6(10)5-2-3-11-7(5)9-4/h2-3H,1H3,(H,8,9,10)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| CAS: | 21582-51-4 |
|---|---|
| MF: | C7H6N2OS |
| Density: | 1.5±0.1 g/cm3 |
| Flash_Point: | 199.8±25.4 °C |
| Melting_Point: | N/A |
| Product_Name: | 6-Methylthieno[2,3-d]pyrimidin-4(3H)-one |
| Symbol: | GHS07 |
| Bolling_Point: | 406.7±33.0 °C at 760 mmHg |
| FW: | 166.200 |
| Bolling_Point: | 406.7±33.0 °C at 760 mmHg |
|---|---|
| Density: | 1.5±0.1 g/cm3 |
| MF: | C7H6N2OS |
| LogP: | 0.38 |
| Exact_Mass: | 166.020081 |
| Vapor_Pressure: | 0.0±0.9 mmHg at 25°C |
| Flash_Point: | 199.8±25.4 °C |
| FW: | 166.200 |
| Refractive_Index: | 1.753 |
| PSA: | 73.99000 |
| Symbol: | GHS07 |
|---|---|
| HS_Code: | 2934999090 |
| RIDADR: | NONH for all modes of transport |
| Safety_Statements: | H302 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-